About cyclohexanecarbaldehyde;1-prop-2-enylcyclohexane-1-carbaldehyde
cyclohexanecarbaldehyde;1-prop-2-enylcyclohexane-1-carbaldehyde (PubChem CID 158217292) has the molecular formula C17H28O2
and a molecular weight of 264.41 g/mol. Its IUPAC name is cyclohexanecarbaldehyde;1-prop-2-enylcyclohexane-1-carbaldehyde.
Molecular Properties
| Compound Name | cyclohexanecarbaldehyde;1-prop-2-enylcyclohexane-1-carbaldehyde |
| PubChem CID | 158217292 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | cyclohexanecarbaldehyde;1-prop-2-enylcyclohexane-1-carbaldehyde |
| SMILES | C=CCC1(C=O)CCCCC1.O=CC1CCCCC1 |
| InChI | InChI=1S/C10H16O.C7H12O/c1-2-6-10(9-11)7-4-3-5-8-10;8-6-7-4-2-1-3-5-7/h2,9H,1,3-8H2;6-7H,1-5H2 |
| InChIKey | GCUUNWBWJHJYFV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohexanecarbaldehyde;1-prop-2-enylcyclohexane-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanecarbaldehyde;1-prop-2-enylcyclohexane-1-carbaldehyde?
The IUPAC name of cyclohexanecarbaldehyde;1-prop-2-enylcyclohexane-1-carbaldehyde (CID 158217292) is cyclohexanecarbaldehyde;1-prop-2-enylcyclohexane-1-carbaldehyde.
What is the SMILES notation for cyclohexanecarbaldehyde;1-prop-2-enylcyclohexane-1-carbaldehyde?
The canonical SMILES for cyclohexanecarbaldehyde;1-prop-2-enylcyclohexane-1-carbaldehyde is C=CCC1(C=O)CCCCC1.O=CC1CCCCC1.
What is the InChIKey of cyclohexanecarbaldehyde;1-prop-2-enylcyclohexane-1-carbaldehyde?
The InChIKey is GCUUNWBWJHJYFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O.C7H12O/c1-2-6-10(9-11)7-4-3-5-8-10;8-6-7-4-2-1-3-5-7/h2,9H,1,3-8H2;6-7H,1-5H2.
What are the key properties of cyclohexanecarbaldehyde;1-prop-2-enylcyclohexane-1-carbaldehyde?
cyclohexanecarbaldehyde;1-prop-2-enylcyclohexane-1-carbaldehyde has a molecular weight of 264.41 g/mol, XLogP of 4.48, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanecarbaldehyde;1-prop-2-enylcyclohexane-1-carbaldehyde is sourced from PubChem (CID 158217292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).