C12H20O7 — CID 101247131
[(2R,3R,4S,5S,6S)-3,5-dihydroxy-6-methoxy-4-prop-2-enoxyoxan-2-yl]methyl acetate (PubChem CID 101247131) has the molecular formula C12H20O7 and a molecular weight of 276.29 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-3,5-dihydroxy-6-methoxy-4-prop-2-enoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-3,5-dihydroxy-6-methoxy-4-prop-2-enoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101247131 |
| Molecular Formula | C12H20O7 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3,5-dihydroxy-6-methoxy-4-prop-2-enoxyoxan-2-yl]methyl acetate |
| SMILES | C=CCO[C@@H]1[C@H](O)[C@@H](OC)O[C@H](COC(C)=O)[C@H]1O |
| InChI | InChI=1S/C12H20O7/c1-4-5-17-11-9(14)8(6-18-7(2)13)19-12(16-3)10(11)15/h4,8-12,14-15H,1,5-6H2,2-3H3/t8-,9-,10+,11+,12+/m1/s1 |
| InChIKey | LJJMMOIKAGISNL-GCHJQGSQSA-N |
| XLogP | -0.79 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|