C10H18O5 — CID 14824471
(2R,3R,4R,5S,6S)-2-methoxy-6-methyl-4-prop-2-enoxyoxane-3,5-diol (PubChem CID 14824471) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-2-methoxy-6-methyl-4-prop-2-enoxyoxane-3,5-diol.
| Compound Name | (2R,3R,4R,5S,6S)-2-methoxy-6-methyl-4-prop-2-enoxyoxane-3,5-diol |
|---|---|
| PubChem CID | 14824471 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | (2R,3R,4R,5S,6S)-2-methoxy-6-methyl-4-prop-2-enoxyoxane-3,5-diol |
| SMILES | C=CCO[C@@H]1[C@@H](O)[C@H](C)O[C@@H](OC)[C@@H]1O |
| InChI | InChI=1S/C10H18O5/c1-4-5-14-9-7(11)6(2)15-10(13-3)8(9)12/h4,6-12H,1,5H2,2-3H3/t6-,7-,8+,9+,10+/m0/s1 |
| InChIKey | PRBOFDGLDFKPMJ-SRQGCSHVSA-N |
| XLogP | -0.33 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|