C12H20O6 — CID 10869017
(1R,2S,4S,5S)-3,6-bis(prop-2-enoxy)cyclohexane-1,2,4,5-tetrol (PubChem CID 10869017) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is (1R,2S,4S,5S)-3,6-bis(prop-2-enoxy)cyclohexane-1,2,4,5-tetrol.
| Compound Name | (1R,2S,4S,5S)-3,6-bis(prop-2-enoxy)cyclohexane-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 10869017 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (1R,2S,4S,5S)-3,6-bis(prop-2-enoxy)cyclohexane-1,2,4,5-tetrol |
| SMILES | C=CCOC1[C@@H](O)[C@H](O)C(OCC=C)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H20O6/c1-3-5-17-11-7(13)9(15)12(18-6-4-2)10(16)8(11)14/h3-4,7-16H,1-2,5-6H2/t7-,8-,9-,10+,11?,12?/m0/s1 |
| InChIKey | WYNFBKAMHFSTHW-ZYOVFQDESA-N |
| XLogP | -1.41 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|