C8H12O5 — CID 91133806
(2S,3R,4R,5S)-4,5-dihydroxy-3-prop-2-enoxyoxolane-2-carbaldehyde (PubChem CID 91133806) has the molecular formula C8H12O5 and a molecular weight of 188.18 g/mol. Its IUPAC name is (2S,3R,4R,5S)-4,5-dihydroxy-3-prop-2-enoxyoxolane-2-carbaldehyde.
| Compound Name | (2S,3R,4R,5S)-4,5-dihydroxy-3-prop-2-enoxyoxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 91133806 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | (2S,3R,4R,5S)-4,5-dihydroxy-3-prop-2-enoxyoxolane-2-carbaldehyde |
| SMILES | C=CCO[C@@H]1[C@@H](O)[C@@H](O)O[C@@H]1C=O |
| InChI | InChI=1S/C8H12O5/c1-2-3-12-7-5(4-9)13-8(11)6(7)10/h2,4-8,10-11H,1,3H2/t5-,6-,7+,8+/m1/s1 |
| InChIKey | JPTQOUVQMJDMFP-NGJRWZKOSA-N |
| XLogP | -1.17 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|