C10H18O6 — CID 88954386
(3S,6R)-4-butoxy-3,5,6-trihydroxyoxane-2-carbaldehyde (PubChem CID 88954386) has the molecular formula C10H18O6 and a molecular weight of 234.25 g/mol. Its IUPAC name is (3S,6R)-4-butoxy-3,5,6-trihydroxyoxane-2-carbaldehyde.
| Compound Name | (3S,6R)-4-butoxy-3,5,6-trihydroxyoxane-2-carbaldehyde |
|---|---|
| PubChem CID | 88954386 |
| Molecular Formula | C10H18O6 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | (3S,6R)-4-butoxy-3,5,6-trihydroxyoxane-2-carbaldehyde |
| SMILES | CCCCOC1C(O)[C@H](O)OC(C=O)[C@H]1O |
| InChI | InChI=1S/C10H18O6/c1-2-3-4-15-9-7(12)6(5-11)16-10(14)8(9)13/h5-10,12-14H,2-4H2,1H3/t6?,7-,8?,9?,10-/m1/s1 |
| InChIKey | CZALUVUVKCNCHI-AZKXTHKGSA-N |
| XLogP | -1.19 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|