C18H28O6 — CID 15666729
3,4,5,6-tetrakis(prop-2-enoxy)cyclohexane-1,2-diol (PubChem CID 15666729) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is 3,4,5,6-tetrakis(prop-2-enoxy)cyclohexane-1,2-diol.
| Compound Name | 3,4,5,6-tetrakis(prop-2-enoxy)cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 15666729 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 3,4,5,6-tetrakis(prop-2-enoxy)cyclohexane-1,2-diol |
| SMILES | C=CCOC1C(O)C(O)C(OCC=C)C(OCC=C)C1OCC=C |
| InChI | InChI=1S/C18H28O6/c1-5-9-21-15-13(19)14(20)16(22-10-6-2)18(24-12-8-4)17(15)23-11-7-3/h5-8,13-20H,1-4,9-12H2 |
| InChIKey | COHMXZMSKHAYTO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|