C12H22O6 — CID 12660648
(2R,3R,4R,5R)-3,4-bis(prop-2-enoxy)hexane-1,2,5,6-tetrol (PubChem CID 12660648) has the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. Its IUPAC name is (2R,3R,4R,5R)-3,4-bis(prop-2-enoxy)hexane-1,2,5,6-tetrol.
| Compound Name | (2R,3R,4R,5R)-3,4-bis(prop-2-enoxy)hexane-1,2,5,6-tetrol |
|---|---|
| PubChem CID | 12660648 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (2R,3R,4R,5R)-3,4-bis(prop-2-enoxy)hexane-1,2,5,6-tetrol |
| SMILES | C=CCO[C@@H]([C@H](OCC=C)[C@H](O)CO)[C@H](O)CO |
| InChI | InChI=1S/C12H22O6/c1-3-5-17-11(9(15)7-13)12(10(16)8-14)18-6-4-2/h3-4,9-16H,1-2,5-8H2/t9-,10-,11-,12-/m1/s1 |
| InChIKey | VVUHDZSEEOJGBD-DDHJBXDOSA-N |
| XLogP | -1.16 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|