C11H16O5 — CID 145057639
(2S,3S,4R,5R,6R)-2-ethynyl-6-methoxy-4-prop-2-enoxyoxane-3,5-diol (PubChem CID 145057639) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R)-2-ethynyl-6-methoxy-4-prop-2-enoxyoxane-3,5-diol.
| Compound Name | (2S,3S,4R,5R,6R)-2-ethynyl-6-methoxy-4-prop-2-enoxyoxane-3,5-diol |
|---|---|
| PubChem CID | 145057639 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (2S,3S,4R,5R,6R)-2-ethynyl-6-methoxy-4-prop-2-enoxyoxane-3,5-diol |
| SMILES | C#C[C@@H]1O[C@@H](OC)[C@H](O)[C@H](OCC=C)[C@H]1O |
| InChI | InChI=1S/C11H16O5/c1-4-6-15-10-8(12)7(5-2)16-11(14-3)9(10)13/h2,4,7-13H,1,6H2,3H3/t7-,8-,9+,10+,11+/m0/s1 |
| InChIKey | MAKXMZRWECWXQP-FBDQPXRJSA-N |
| XLogP | -0.72 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|