C20H36O6 — CID 59046317
(2S,4S,5S)-6-ethyl-4-[(2S,4S,5S)-6-ethyl-3-hydroxy-5-methyl-4-prop-2-enoxyoxan-2-yl]oxy-2,5-dimethyloxan-3-ol (PubChem CID 59046317) has the molecular formula C20H36O6 and a molecular weight of 372.50 g/mol. Its IUPAC name is (2S,4S,5S)-6-ethyl-4-[(2S,4S,5S)-6-ethyl-3-hydroxy-5-methyl-4-prop-2-enoxyoxan-2-yl]oxy-2,5-dimethyloxan-3-ol.
| Compound Name | (2S,4S,5S)-6-ethyl-4-[(2S,4S,5S)-6-ethyl-3-hydroxy-5-methyl-4-prop-2-enoxyoxan-2-yl]oxy-2,5-dimethyloxan-3-ol |
|---|---|
| PubChem CID | 59046317 |
| Molecular Formula | C20H36O6 |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | (2S,4S,5S)-6-ethyl-4-[(2S,4S,5S)-6-ethyl-3-hydroxy-5-methyl-4-prop-2-enoxyoxan-2-yl]oxy-2,5-dimethyloxan-3-ol |
| SMILES | C=CCO[C@@H]1C(O)[C@H](O[C@@H]2C(O)[C@H](C)OC(CC)[C@@H]2C)OC(CC)[C@@H]1C |
| InChI | InChI=1S/C20H36O6/c1-7-10-23-18-11(4)15(9-3)25-20(17(18)22)26-19-12(5)14(8-2)24-13(6)16(19)21/h7,11-22H,1,8-10H2,2-6H3/t11-,12-,13-,14?,15?,16?,17?,18-,19-,20-/m0/s1 |
| InChIKey | PYXIDQDZTQCPFA-KJICFNTMSA-N |
| XLogP | 2.27 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|