C13H20Cl3NO4 — CID 159461994
[(2R,4S,5R)-6-ethyl-3-hydroxy-5-methyl-4-prop-2-enoxyoxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 159461994) has the molecular formula C13H20Cl3NO4 and a molecular weight of 360.67 g/mol. Its IUPAC name is [(2R,4S,5R)-6-ethyl-3-hydroxy-5-methyl-4-prop-2-enoxyoxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2R,4S,5R)-6-ethyl-3-hydroxy-5-methyl-4-prop-2-enoxyoxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 159461994 |
| Molecular Formula | C13H20Cl3NO4 |
| Molecular Weight | 360.67 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | [(2R,4S,5R)-6-ethyl-3-hydroxy-5-methyl-4-prop-2-enoxyoxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@H]1OC(CC)[C@@H](C)[C@H](OCC=C)C1O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H20Cl3NO4/c1-4-6-19-10-7(3)8(5-2)20-11(9(10)18)21-12(17)13(14,15)16/h4,7-11,17-18H,1,5-6H2,2-3H3/b17-12+/t7-,8?,9?,10+,11-/m1/s1 |
| InChIKey | GMKFWZUBGOAIPL-BKWIEXFESA-N |
| XLogP | 3.05 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.67 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|