C14H18Cl3NO9 — CID 142704307
[(2R,3R,4R,5S)-3,4-bis[(2-deuterioacetyl)oxy]-5-hydroxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl 2-deuterioacetate (PubChem CID 142704307) has the molecular formula C14H18Cl3NO9 and a molecular weight of 453.67 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4-bis[(2-deuterioacetyl)oxy]-5-hydroxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl 2-deuterioacetate.
| Compound Name | [(2R,3R,4R,5S)-3,4-bis[(2-deuterioacetyl)oxy]-5-hydroxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl 2-deuterioacetate |
|---|---|
| PubChem CID | 142704307 |
| Molecular Formula | C14H18Cl3NO9 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4-bis[(2-deuterioacetyl)oxy]-5-hydroxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl 2-deuterioacetate |
| SMILES | [H]/N=C(/OC1O[C@H](COC(=O)C[2H])[C@@H](OC(=O)C[2H])[C@H](OC(=O)C[2H])[C@@H]1O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H18Cl3NO9/c1-5(19)23-4-8-10(24-6(2)20)11(25-7(3)21)9(22)12(26-8)27-13(18)14(15,16)17/h8-12,18,22H,4H2,1-3H3/b18-13+/t8-,9+,10-,11-,12?/m1/s1/i1D,2D,3D |
| InChIKey | YHNPEEVSAPOOQL-XSOAKJIYSA-N |
| XLogP | 0.86 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|