C8H9ClO3 — CID 10058299
2-chloro-4-hydroxy-3-methoxy-4-prop-2-enylcyclobut-2-en-1-one (PubChem CID 10058299) has the molecular formula C8H9ClO3 and a molecular weight of 188.61 g/mol. Its IUPAC name is 2-chloro-4-hydroxy-3-methoxy-4-prop-2-enylcyclobut-2-en-1-one.
| Compound Name | 2-chloro-4-hydroxy-3-methoxy-4-prop-2-enylcyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10058299 |
| Molecular Formula | C8H9ClO3 |
| Molecular Weight | 188.61 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | 2-chloro-4-hydroxy-3-methoxy-4-prop-2-enylcyclobut-2-en-1-one |
| SMILES | C=CCC1(O)C(=O)C(Cl)=C1OC |
| InChI | InChI=1S/C8H9ClO3/c1-3-4-8(11)6(10)5(9)7(8)12-2/h3,11H,1,4H2,2H3 |
| InChIKey | ZOSGOXYWKJDCBG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.61 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|