C18H16O4 — CID 12065684
4,10-dihydroxy-3-methoxy-10-prop-2-enylanthracen-9-one (PubChem CID 12065684) has the molecular formula C18H16O4 and a molecular weight of 296.32 g/mol. Its IUPAC name is 4,10-dihydroxy-3-methoxy-10-prop-2-enylanthracen-9-one.
| Compound Name | 4,10-dihydroxy-3-methoxy-10-prop-2-enylanthracen-9-one |
|---|---|
| PubChem CID | 12065684 |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4,10-dihydroxy-3-methoxy-10-prop-2-enylanthracen-9-one |
| SMILES | C=CCC1(O)c2ccccc2C(=O)c2ccc(OC)c(O)c21 |
| InChI | InChI=1S/C18H16O4/c1-3-10-18(21)13-7-5-4-6-11(13)16(19)12-8-9-14(22-2)17(20)15(12)18/h3-9,20-21H,1,10H2,2H3 |
| InChIKey | QOIPBSRREDTEOQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|