C20H20O3 — CID 24890309
(2E)-2-[(3,4-dimethoxyphenyl)methylidene]-3,3-dimethylinden-1-one (PubChem CID 24890309) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is (2E)-2-[(3,4-dimethoxyphenyl)methylidene]-3,3-dimethylinden-1-one.
| Compound Name | (2E)-2-[(3,4-dimethoxyphenyl)methylidene]-3,3-dimethylinden-1-one |
|---|---|
| PubChem CID | 24890309 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (2E)-2-[(3,4-dimethoxyphenyl)methylidene]-3,3-dimethylinden-1-one |
| SMILES | COc1ccc(/C=C2/C(=O)c3ccccc3C2(C)C)cc1OC |
| InChI | InChI=1S/C20H20O3/c1-20(2)15-8-6-5-7-14(15)19(21)16(20)11-13-9-10-17(22-3)18(12-13)23-4/h5-12H,1-4H3/b16-11- |
| InChIKey | JWGCHKOVAKTYSM-WJDWOHSUSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|