C18H16O2 — CID 5468268
(1E)-1-[(3,4-dimethoxyphenyl)methylidene]indene (PubChem CID 5468268) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is (1E)-1-[(3,4-dimethoxyphenyl)methylidene]indene.
| Compound Name | (1E)-1-[(3,4-dimethoxyphenyl)methylidene]indene |
|---|---|
| PubChem CID | 5468268 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (1E)-1-[(3,4-dimethoxyphenyl)methylidene]indene |
| SMILES | COc1ccc(/C=C2\C=Cc3ccccc32)cc1OC |
| InChI | InChI=1S/C18H16O2/c1-19-17-10-7-13(12-18(17)20-2)11-15-9-8-14-5-3-4-6-16(14)15/h3-12H,1-2H3/b15-11+ |
| InChIKey | HGNGSNBKARRPLI-RVDMUPIBSA-N |
| XLogP | 4.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|