C17H13Br2N — CID 56689216
2,6-dibromo-4-[(Z)-inden-1-ylidenemethyl]-N-methylaniline (PubChem CID 56689216) has the molecular formula C17H13Br2N and a molecular weight of 391.11 g/mol. Its IUPAC name is 2,6-dibromo-4-[(Z)-inden-1-ylidenemethyl]-N-methylaniline.
| Compound Name | 2,6-dibromo-4-[(Z)-inden-1-ylidenemethyl]-N-methylaniline |
|---|---|
| PubChem CID | 56689216 |
| Molecular Formula | C17H13Br2N |
| Molecular Weight | 391.11 g/mol |
| Exact Mass | 388.94 |
| IUPAC Name | 2,6-dibromo-4-[(Z)-inden-1-ylidenemethyl]-N-methylaniline |
| SMILES | CNc1c(Br)cc(/C=C2/C=Cc3ccccc32)cc1Br |
| InChI | InChI=1S/C17H13Br2N/c1-20-17-15(18)9-11(10-16(17)19)8-13-7-6-12-4-2-3-5-14(12)13/h2-10,20H,1H3/b13-8- |
| InChIKey | KPNSXKFHLWKXNV-JYRVWZFOSA-N |
| XLogP | 5.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.11 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|