C18H18OS2 — CID 11771423
2-[bis(methylsulfanyl)methylidene]-1-prop-2-enylacenaphthylen-1-ol (PubChem CID 11771423) has the molecular formula C18H18OS2 and a molecular weight of 314.48 g/mol. Its IUPAC name is 2-[bis(methylsulfanyl)methylidene]-1-prop-2-enylacenaphthylen-1-ol.
| Compound Name | 2-[bis(methylsulfanyl)methylidene]-1-prop-2-enylacenaphthylen-1-ol |
|---|---|
| PubChem CID | 11771423 |
| Molecular Formula | C18H18OS2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-[bis(methylsulfanyl)methylidene]-1-prop-2-enylacenaphthylen-1-ol |
| SMILES | C=CCC1(O)C(=C(SC)SC)c2cccc3cccc1c23 |
| InChI | InChI=1S/C18H18OS2/c1-4-11-18(19)14-10-6-8-12-7-5-9-13(15(12)14)16(18)17(20-2)21-3/h4-10,19H,1,11H2,2-3H3 |
| InChIKey | MGLKAIQXXBUKCN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|