C37H32O3 — CID 163664224
26-methyl-9,18-bis(prop-2-enyl)-27-prop-2-ynylheptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,22,24-undecaene-9,18,27-triol (PubChem CID 163664224) has the molecular formula C37H32O3 and a molecular weight of 524.66 g/mol. Its IUPAC name is 26-methyl-9,18-bis(prop-2-enyl)-27-prop-2-ynylheptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,22,24-undecaene-9,18,27-triol.
| Compound Name | 26-methyl-9,18-bis(prop-2-enyl)-27-prop-2-ynylheptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,22,24-undecaene-9,18,27-triol |
|---|---|
| PubChem CID | 163664224 |
| Molecular Formula | C37H32O3 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | 26-methyl-9,18-bis(prop-2-enyl)-27-prop-2-ynylheptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,22,24-undecaene-9,18,27-triol |
| SMILES | C#CCC1(O)c2c3c(c4c(c2C2C=CC=CC21C)C(O)(CC=C)c1ccccc1-4)C(O)(CC=C)c1ccccc1-3 |
| InChI | InChI=1S/C37H32O3/c1-5-19-35(38)26-17-11-9-15-24(26)29-31(35)28-23-14-8-10-16-25(23)36(39,20-6-2)32(28)30-27-18-12-13-22-34(27,4)37(40,21-7-3)33(29)30/h3,5-6,8-18,22,27,38-40H,1-2,19-21H2,4H3 |
| InChIKey | IWZNKAKVLICEDT-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|