About 3-[10,10-bis(prop-2-enyl)anthracen-9-ylidene]-N,N-dimethylpropan-1-amine
3-[10,10-bis(prop-2-enyl)anthracen-9-ylidene]-N,N-dimethylpropan-1-amine (PubChem CID 1203583) has the molecular formula C25H29N
and a molecular weight of 343.51 g/mol. Its IUPAC name is 3-[10,10-bis(prop-2-enyl)anthracen-9-ylidene]-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[10,10-bis(prop-2-enyl)anthracen-9-ylidene]-N,N-dimethylpropan-1-amine |
| PubChem CID | 1203583 |
| Molecular Formula | C25H29N |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 3-[10,10-bis(prop-2-enyl)anthracen-9-ylidene]-N,N-dimethylpropan-1-amine |
| SMILES | C=CCC1(CC=C)c2ccccc2C(=CCCN(C)C)c2ccccc21 |
| InChI | InChI=1S/C25H29N/c1-5-17-25(18-6-2)23-15-9-7-12-21(23)20(14-11-19-26(3)4)22-13-8-10-16-24(22)25/h5-10,12-16H,1-2,11,17-19H2,3-4H3 |
| InChIKey | CZKYUQVWCSHJHO-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[10,10-bis(prop-2-enyl)anthracen-9-ylidene]-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[10,10-bis(prop-2-enyl)anthracen-9-ylidene]-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-[10,10-bis(prop-2-enyl)anthracen-9-ylidene]-N,N-dimethylpropan-1-amine (CID 1203583) is 3-[10,10-bis(prop-2-enyl)anthracen-9-ylidene]-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-[10,10-bis(prop-2-enyl)anthracen-9-ylidene]-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-[10,10-bis(prop-2-enyl)anthracen-9-ylidene]-N,N-dimethylpropan-1-amine is C=CCC1(CC=C)c2ccccc2C(=CCCN(C)C)c2ccccc21.
What is the InChIKey of 3-[10,10-bis(prop-2-enyl)anthracen-9-ylidene]-N,N-dimethylpropan-1-amine?
The InChIKey is CZKYUQVWCSHJHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29N/c1-5-17-25(18-6-2)23-15-9-7-12-21(23)20(14-11-19-26(3)4)22-13-8-10-16-24(22)25/h5-10,12-16H,1-2,11,17-19H2,3-4H3.
What are the key properties of 3-[10,10-bis(prop-2-enyl)anthracen-9-ylidene]-N,N-dimethylpropan-1-amine?
3-[10,10-bis(prop-2-enyl)anthracen-9-ylidene]-N,N-dimethylpropan-1-amine has a molecular weight of 343.51 g/mol, XLogP of 5.82, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[10,10-bis(prop-2-enyl)anthracen-9-ylidene]-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 1203583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).