C45H42 — CID 11628484
9,9,18,18,27,27-hexakis(prop-2-enyl)heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaene (PubChem CID 11628484) has the molecular formula C45H42 and a molecular weight of 582.83 g/mol. Its IUPAC name is 9,9,18,18,27,27-hexakis(prop-2-enyl)heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaene.
| Compound Name | 9,9,18,18,27,27-hexakis(prop-2-enyl)heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaene |
|---|---|
| PubChem CID | 11628484 |
| Molecular Formula | C45H42 |
| Molecular Weight | 582.83 g/mol |
| Exact Mass | 582.33 |
| IUPAC Name | 9,9,18,18,27,27-hexakis(prop-2-enyl)heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaene |
| SMILES | C=CCC1(CC=C)c2ccccc2-c2c1c1c(c3c2C(CC=C)(CC=C)c2ccccc2-3)C(CC=C)(CC=C)c2ccccc2-1 |
| InChI | InChI=1S/C45H42/c1-7-25-43(26-8-2)34-22-16-13-19-31(34)37-40(43)38-32-20-14-17-23-35(32)44(27-9-3,28-10-4)42(38)39-33-21-15-18-24-36(33)45(29-11-5,30-12-6)41(37)39/h7-24H,1-6,25-30H2 |
| InChIKey | NJYVWDSIMKINRJ-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.83 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|