C19H22 — CID 143545860
4,4-bis(prop-2-enyl)-2H-cyclopenta[a]indene;methane (PubChem CID 143545860) has the molecular formula C19H22 and a molecular weight of 250.38 g/mol. Its IUPAC name is 4,4-bis(prop-2-enyl)-2H-cyclopenta[a]indene;methane.
| Compound Name | 4,4-bis(prop-2-enyl)-2H-cyclopenta[a]indene;methane |
|---|---|
| PubChem CID | 143545860 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 4,4-bis(prop-2-enyl)-2H-cyclopenta[a]indene;methane |
| SMILES | C.C=CCC1(CC=C)C2=CCC=C2c2ccccc21 |
| InChI | InChI=1S/C18H18.CH4/c1-3-12-18(13-4-2)16-10-6-5-8-14(16)15-9-7-11-17(15)18;/h3-6,8-11H,1-2,7,12-13H2;1H4 |
| InChIKey | MILPJPCVYCRKKS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|