C15H16 — CID 123727902
9,9-dimethyl-2,3-dihydrofluorene (PubChem CID 123727902) has the molecular formula C15H16 and a molecular weight of 196.29 g/mol. Its IUPAC name is 9,9-dimethyl-2,3-dihydrofluorene.
| Compound Name | 9,9-dimethyl-2,3-dihydrofluorene |
|---|---|
| PubChem CID | 123727902 |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 9,9-dimethyl-2,3-dihydrofluorene |
| SMILES | CC1(C)C2=CCCC=C2c2ccccc21 |
| InChI | InChI=1S/C15H16/c1-15(2)13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h3,5,7-10H,4,6H2,1-2H3 |
| InChIKey | ONYNVXVGHMSCGT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |