C30H29N — CID 142508992
N-(9,9-dimethyl-2,3-dihydrofluoren-3-yl)-9,9-dimethylfluoren-2-amine (PubChem CID 142508992) has the molecular formula C30H29N and a molecular weight of 403.57 g/mol. Its IUPAC name is N-(9,9-dimethyl-2,3-dihydrofluoren-3-yl)-9,9-dimethylfluoren-2-amine.
| Compound Name | N-(9,9-dimethyl-2,3-dihydrofluoren-3-yl)-9,9-dimethylfluoren-2-amine |
|---|---|
| PubChem CID | 142508992 |
| Molecular Formula | C30H29N |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-(9,9-dimethyl-2,3-dihydrofluoren-3-yl)-9,9-dimethylfluoren-2-amine |
| SMILES | CC1(C)C2=CCC(Nc3ccc4c(c3)C(C)(C)c3ccccc3-4)C=C2c2ccccc21 |
| InChI | InChI=1S/C30H29N/c1-29(2)26-12-8-6-10-22(26)24-17-19(14-16-27(24)29)31-20-13-15-23-21-9-5-7-11-25(21)30(3,4)28(23)18-20/h5-13,15-19,31H,14H2,1-4H3 |
| InChIKey | LMBGYMSJXWVSSV-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |