C77H79N — CID 178110228
N-(9,9-dimethyl-6,7-dihydrofluoren-2-yl)-9,9-dimethyl-N-[4-(2,2',7,7'-tetratert-butyl-9,9'-spirobi[fluorene]-4-yl)phenyl]fluoren-2-amine (PubChem CID 178110228) has the molecular formula C77H79N and a molecular weight of 1018.49 g/mol. Its IUPAC name is N-(9,9-dimethyl-6,7-dihydrofluoren-2-yl)-9,9-dimethyl-N-[4-(2,2',7,7'-tetratert-butyl-9,9'-spirobi[fluorene]-4-yl)phenyl]fluoren-2-amine.
| Compound Name | N-(9,9-dimethyl-6,7-dihydrofluoren-2-yl)-9,9-dimethyl-N-[4-(2,2',7,7'-tetratert-butyl-9,9'-spirobi[fluorene]-4-yl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 178110228 |
| Molecular Formula | C77H79N |
| Molecular Weight | 1018.49 g/mol |
| Exact Mass | 1017.62 |
| IUPAC Name | N-(9,9-dimethyl-6,7-dihydrofluoren-2-yl)-9,9-dimethyl-N-[4-(2,2',7,7'-tetratert-butyl-9,9'-spirobi[fluorene]-4-yl)phenyl]fluoren-2-amine |
| SMILES | CC(C)(C)c1ccc2c(c1)C1(c3cc(C(C)(C)C)ccc3-2)c2cc(C(C)(C)C)ccc2-c2c(-c3ccc(N(c4ccc5c(c4)C(C)(C)C4=CCCC=C45)c4ccc5c(c4)C(C)(C)c4ccccc4-5)cc3)cc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C77H79N/c1-71(2,3)47-27-34-58-59-35-28-48(72(4,5)6)41-67(59)77(66(58)40-47)68-42-49(73(7,8)9)29-36-60(68)70-61(39-50(43-69(70)77)74(10,11)12)46-25-30-51(31-26-46)78(52-32-37-56-54-21-17-19-23-62(54)75(13,14)64(56)44-52)53-33-38-57-55-22-18-20-24-63(55)76(15,16)65(57)45-53/h17,19,21-45H,18,20H2,1-16H3 |
| InChIKey | IJGMPDYNULSKCH-UHFFFAOYSA-N |
| XLogP | 21.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1018.49 |
| LogP ≤ 5 | 21.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |