C11H12O — CID 100988172
(7R)-7-prop-2-enylbicyclo[4.2.0]octa-1,3,5-trien-7-ol (PubChem CID 100988172) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is (7R)-7-prop-2-enylbicyclo[4.2.0]octa-1,3,5-trien-7-ol.
| Compound Name | (7R)-7-prop-2-enylbicyclo[4.2.0]octa-1,3,5-trien-7-ol |
|---|---|
| PubChem CID | 100988172 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (7R)-7-prop-2-enylbicyclo[4.2.0]octa-1,3,5-trien-7-ol |
| SMILES | C=CC[C@@]1(O)Cc2ccccc21 |
| InChI | InChI=1S/C11H12O/c1-2-7-11(12)8-9-5-3-4-6-10(9)11/h2-6,12H,1,7-8H2/t11-/m1/s1 |
| InChIKey | QSBJYJJSDBJLDC-LLVKDONJSA-N |
| XLogP | 2.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|