About 3-methyl-3-prop-2-enyl-1,2-dihydroindene
3-methyl-3-prop-2-enyl-1,2-dihydroindene (PubChem CID 85427456) has the molecular formula C13H16
and a molecular weight of 172.27 g/mol. Its IUPAC name is 3-methyl-3-prop-2-enyl-1,2-dihydroindene.
Molecular Properties
| Compound Name | 3-methyl-3-prop-2-enyl-1,2-dihydroindene |
| PubChem CID | 85427456 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 3-methyl-3-prop-2-enyl-1,2-dihydroindene |
| SMILES | C=CCC1(C)CCc2ccccc21 |
| InChI | InChI=1S/C13H16/c1-3-9-13(2)10-8-11-6-4-5-7-12(11)13/h3-7H,1,8-10H2,2H3 |
| InChIKey | OLUNCTBFBUTRGR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-3-prop-2-enyl-1,2-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3-prop-2-enyl-1,2-dihydroindene?
The IUPAC name of 3-methyl-3-prop-2-enyl-1,2-dihydroindene (CID 85427456) is 3-methyl-3-prop-2-enyl-1,2-dihydroindene.
What is the SMILES notation for 3-methyl-3-prop-2-enyl-1,2-dihydroindene?
The canonical SMILES for 3-methyl-3-prop-2-enyl-1,2-dihydroindene is C=CCC1(C)CCc2ccccc21.
What is the InChIKey of 3-methyl-3-prop-2-enyl-1,2-dihydroindene?
The InChIKey is OLUNCTBFBUTRGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16/c1-3-9-13(2)10-8-11-6-4-5-7-12(11)13/h3-7H,1,8-10H2,2H3.
What are the key properties of 3-methyl-3-prop-2-enyl-1,2-dihydroindene?
3-methyl-3-prop-2-enyl-1,2-dihydroindene has a molecular weight of 172.27 g/mol, XLogP of 3.47, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3-prop-2-enyl-1,2-dihydroindene is sourced from PubChem (CID 85427456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).