C13H16O2 — CID 130032329
1-prop-2-enyl-3,4-dihydro-2H-naphthalene-1,6-diol (PubChem CID 130032329) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-prop-2-enyl-3,4-dihydro-2H-naphthalene-1,6-diol.
| Compound Name | 1-prop-2-enyl-3,4-dihydro-2H-naphthalene-1,6-diol |
|---|---|
| PubChem CID | 130032329 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 1-prop-2-enyl-3,4-dihydro-2H-naphthalene-1,6-diol |
| SMILES | C=CCC1(O)CCCc2cc(O)ccc21 |
| InChI | InChI=1S/C13H16O2/c1-2-7-13(15)8-3-4-10-9-11(14)5-6-12(10)13/h2,5-6,9,14-15H,1,3-4,7-8H2 |
| InChIKey | CKSJYCUNRWQIDJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|