C19H21ClO2 — CID 68581134
(2R,4aS,10aS)-2-(2-chloroethynyl)-4a-prop-2-enyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol (PubChem CID 68581134) has the molecular formula C19H21ClO2 and a molecular weight of 316.83 g/mol. Its IUPAC name is (2R,4aS,10aS)-2-(2-chloroethynyl)-4a-prop-2-enyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol.
| Compound Name | (2R,4aS,10aS)-2-(2-chloroethynyl)-4a-prop-2-enyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol |
|---|---|
| PubChem CID | 68581134 |
| Molecular Formula | C19H21ClO2 |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (2R,4aS,10aS)-2-(2-chloroethynyl)-4a-prop-2-enyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol |
| SMILES | C=CC[C@@]12CC[C@](O)(C#CCl)C[C@@H]1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C19H21ClO2/c1-2-7-19-9-8-18(22,10-11-20)13-15(19)4-3-14-12-16(21)5-6-17(14)19/h2,5-6,12,15,21-22H,1,3-4,7-9,13H2/t15-,18-,19+/m0/s1 |
| InChIKey | SUISUESSESAEFD-ZYSHUDEJSA-N |
| XLogP | 3.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|