C24H30O3 — CID 58742309
(2R,3R,4aR,10aR)-2-benzyl-4a-ethyl-3-methyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol (PubChem CID 58742309) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is (2R,3R,4aR,10aR)-2-benzyl-4a-ethyl-3-methyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol.
| Compound Name | (2R,3R,4aR,10aR)-2-benzyl-4a-ethyl-3-methyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol |
|---|---|
| PubChem CID | 58742309 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (2R,3R,4aR,10aR)-2-benzyl-4a-ethyl-3-methyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol |
| SMILES | CC[C@@]12C[C@@](C)(O)[C@](O)(Cc3ccccc3)C[C@H]1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C24H30O3/c1-3-23-16-22(2,26)24(27,14-17-7-5-4-6-8-17)15-19(23)10-9-18-13-20(25)11-12-21(18)23/h4-8,11-13,19,25-27H,3,9-10,14-16H2,1-2H3/t19-,22-,23-,24+/m1/s1 |
| InChIKey | COHBRPVKIQZORM-CDIGIKMISA-N |
| XLogP | 4.12 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |