C17H22O3 — CID 58742307
(3R,4aR,10aR)-4a-ethyl-3,7-dihydroxy-3-methyl-4,9,10,10a-tetrahydro-1H-phenanthren-2-one (PubChem CID 58742307) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (3R,4aR,10aR)-4a-ethyl-3,7-dihydroxy-3-methyl-4,9,10,10a-tetrahydro-1H-phenanthren-2-one.
| Compound Name | (3R,4aR,10aR)-4a-ethyl-3,7-dihydroxy-3-methyl-4,9,10,10a-tetrahydro-1H-phenanthren-2-one |
|---|---|
| PubChem CID | 58742307 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (3R,4aR,10aR)-4a-ethyl-3,7-dihydroxy-3-methyl-4,9,10,10a-tetrahydro-1H-phenanthren-2-one |
| SMILES | CC[C@@]12C[C@@](C)(O)C(=O)C[C@H]1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C17H22O3/c1-3-17-10-16(2,20)15(19)9-12(17)5-4-11-8-13(18)6-7-14(11)17/h6-8,12,18,20H,3-5,9-10H2,1-2H3/t12-,16-,17-/m1/s1 |
| InChIKey | LDXLEIKXHMMGEW-CSMYWGQOSA-N |
| XLogP | 2.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |