C20H25NO3S — CID 58742319
(2S,3S,4aR,10aR)-4a-ethyl-2-(5-methyl-1,3-thiazol-2-yl)-1,3,4,9,10,10a-hexahydrophenanthrene-2,3,7-triol (PubChem CID 58742319) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is (2S,3S,4aR,10aR)-4a-ethyl-2-(5-methyl-1,3-thiazol-2-yl)-1,3,4,9,10,10a-hexahydrophenanthrene-2,3,7-triol.
| Compound Name | (2S,3S,4aR,10aR)-4a-ethyl-2-(5-methyl-1,3-thiazol-2-yl)-1,3,4,9,10,10a-hexahydrophenanthrene-2,3,7-triol |
|---|---|
| PubChem CID | 58742319 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (2S,3S,4aR,10aR)-4a-ethyl-2-(5-methyl-1,3-thiazol-2-yl)-1,3,4,9,10,10a-hexahydrophenanthrene-2,3,7-triol |
| SMILES | CC[C@@]12C[C@H](O)[C@](O)(c3ncc(C)s3)C[C@H]1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C20H25NO3S/c1-3-19-10-17(23)20(24,18-21-11-12(2)25-18)9-14(19)5-4-13-8-15(22)6-7-16(13)19/h6-8,11,14,17,22-24H,3-5,9-10H2,1-2H3/t14-,17+,19-,20+/m1/s1 |
| InChIKey | RXHSXBZONUIDJC-FPWFTKFVSA-N |
| XLogP | 3.41 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |