C30H34N2O3 — CID 66549171
(1R,11S,13R,14R)-1-ethyl-13,14-dihydroxy-N-(2-methyl-3-pyridinyl)-13-phenyltricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-5-carboxamide (PubChem CID 66549171) has the molecular formula C30H34N2O3 and a molecular weight of 470.61 g/mol. Its IUPAC name is (1R,11S,13R,14R)-1-ethyl-13,14-dihydroxy-N-(2-methyl-3-pyridinyl)-13-phenyltricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-5-carboxamide.
| Compound Name | (1R,11S,13R,14R)-1-ethyl-13,14-dihydroxy-N-(2-methyl-3-pyridinyl)-13-phenyltricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-5-carboxamide |
|---|---|
| PubChem CID | 66549171 |
| Molecular Formula | C30H34N2O3 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | (1R,11S,13R,14R)-1-ethyl-13,14-dihydroxy-N-(2-methyl-3-pyridinyl)-13-phenyltricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-5-carboxamide |
| SMILES | CC[C@@]12C[C@@H](O)[C@](O)(c3ccccc3)C[C@@H]1CCCc1cc(C(=O)Nc3cccnc3C)ccc12 |
| InChI | InChI=1S/C30H34N2O3/c1-3-29-19-27(33)30(35,23-10-5-4-6-11-23)18-24(29)12-7-9-21-17-22(14-15-25(21)29)28(34)32-26-13-8-16-31-20(26)2/h4-6,8,10-11,13-17,24,27,33,35H,3,7,9,12,18-19H2,1-2H3,(H,32,34)/t24-,27+,29+,30+/m0/s1 |
| InChIKey | CVMHIQCHIHDIMK-JYLYBSOGSA-N |
| XLogP | 5.29 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |