C27H36N2O2 — CID 140595348
(1S,11R,13S)-1-ethyl-13-hydroxy-N-(2-methyl-3-pyridinyl)-13-propyltricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-5-carboxamide (PubChem CID 140595348) has the molecular formula C27H36N2O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is (1S,11R,13S)-1-ethyl-13-hydroxy-N-(2-methyl-3-pyridinyl)-13-propyltricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-5-carboxamide.
| Compound Name | (1S,11R,13S)-1-ethyl-13-hydroxy-N-(2-methyl-3-pyridinyl)-13-propyltricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-5-carboxamide |
|---|---|
| PubChem CID | 140595348 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | (1S,11R,13S)-1-ethyl-13-hydroxy-N-(2-methyl-3-pyridinyl)-13-propyltricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-5-carboxamide |
| SMILES | CCC[C@]1(O)CC[C@]2(CC)c3ccc(C(=O)Nc4cccnc4C)cc3CCC[C@@H]2C1 |
| InChI | InChI=1S/C27H36N2O2/c1-4-13-26(31)14-15-27(5-2)22(18-26)9-6-8-20-17-21(11-12-23(20)27)25(30)29-24-10-7-16-28-19(24)3/h7,10-12,16-17,22,31H,4-6,8-9,13-15,18H2,1-3H3,(H,29,30)/t22-,26+,27+/m1/s1 |
| InChIKey | UELAAXUYLJAABR-ICTDUYRTSA-N |
| XLogP | 5.96 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |