C28H35F3N2O2 — CID 66549928
(1S,11S,13S)-13-hydroxy-13-(2-methylpropyl)-N-(2-methyl-3-pyridinyl)-1-(2,2,2-trifluoroethyl)tricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-5-carboxamide (PubChem CID 66549928) has the molecular formula C28H35F3N2O2 and a molecular weight of 488.59 g/mol. Its IUPAC name is (1S,11S,13S)-13-hydroxy-13-(2-methylpropyl)-N-(2-methyl-3-pyridinyl)-1-(2,2,2-trifluoroethyl)tricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-5-carboxamide.
| Compound Name | (1S,11S,13S)-13-hydroxy-13-(2-methylpropyl)-N-(2-methyl-3-pyridinyl)-1-(2,2,2-trifluoroethyl)tricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-5-carboxamide |
|---|---|
| PubChem CID | 66549928 |
| Molecular Formula | C28H35F3N2O2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | (1S,11S,13S)-13-hydroxy-13-(2-methylpropyl)-N-(2-methyl-3-pyridinyl)-1-(2,2,2-trifluoroethyl)tricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-5-carboxamide |
| SMILES | Cc1ncccc1NC(=O)c1ccc2c(c1)CCC[C@H]1C[C@@](O)(CC(C)C)CC[C@@]21CC(F)(F)F |
| InChI | InChI=1S/C28H35F3N2O2/c1-18(2)15-26(35)11-12-27(17-28(29,30)31)22(16-26)7-4-6-20-14-21(9-10-23(20)27)25(34)33-24-8-5-13-32-19(24)3/h5,8-10,13-14,18,22,35H,4,6-7,11-12,15-17H2,1-3H3,(H,33,34)/t22-,26-,27-/m0/s1 |
| InChIKey | AVBSXMQSPVUWFK-CAVYSCNFSA-N |
| XLogP | 6.75 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |