C30H31F3N2O — CID 154694762
(4bS,7S,8aR)-4b-benzyl-7-methyl-N-(2-methyl-3-pyridinyl)-7-(trifluoromethyl)-5,6,8,8a,9,10-hexahydrophenanthrene-2-carboxamide (PubChem CID 154694762) has the molecular formula C30H31F3N2O and a molecular weight of 492.59 g/mol. Its IUPAC name is (4bS,7S,8aR)-4b-benzyl-7-methyl-N-(2-methyl-3-pyridinyl)-7-(trifluoromethyl)-5,6,8,8a,9,10-hexahydrophenanthrene-2-carboxamide.
| Compound Name | (4bS,7S,8aR)-4b-benzyl-7-methyl-N-(2-methyl-3-pyridinyl)-7-(trifluoromethyl)-5,6,8,8a,9,10-hexahydrophenanthrene-2-carboxamide |
|---|---|
| PubChem CID | 154694762 |
| Molecular Formula | C30H31F3N2O |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | (4bS,7S,8aR)-4b-benzyl-7-methyl-N-(2-methyl-3-pyridinyl)-7-(trifluoromethyl)-5,6,8,8a,9,10-hexahydrophenanthrene-2-carboxamide |
| SMILES | Cc1ncccc1NC(=O)c1ccc2c(c1)CC[C@@H]1C[C@@](C)(C(F)(F)F)CC[C@@]21Cc1ccccc1 |
| InChI | InChI=1S/C30H31F3N2O/c1-20-26(9-6-16-34-20)35-27(36)23-11-13-25-22(17-23)10-12-24-19-28(2,30(31,32)33)14-15-29(24,25)18-21-7-4-3-5-8-21/h3-9,11,13,16-17,24H,10,12,14-15,18-19H2,1-2H3,(H,35,36)/t24-,28+,29+/m1/s1 |
| InChIKey | JMNULYJKYASXAM-MHZHKKNFSA-N |
| XLogP | 7.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |