C35H36N2NaO3+ — CID 45102226
sodium (4bR,6R,7R,8aR)-4b-benzyl-6,7-dihydroxy-6-methyl-N-(2-methyl-3-pyridinyl)-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthrene-2-carboxamide (PubChem CID 45102226) has the molecular formula C35H36N2NaO3+ and a molecular weight of 555.67 g/mol. Its IUPAC name is sodium (4bR,6R,7R,8aR)-4b-benzyl-6,7-dihydroxy-6-methyl-N-(2-methyl-3-pyridinyl)-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthrene-2-carboxamide.
| Compound Name | sodium (4bR,6R,7R,8aR)-4b-benzyl-6,7-dihydroxy-6-methyl-N-(2-methyl-3-pyridinyl)-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthrene-2-carboxamide |
|---|---|
| PubChem CID | 45102226 |
| Molecular Formula | C35H36N2NaO3+ |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | sodium (4bR,6R,7R,8aR)-4b-benzyl-6,7-dihydroxy-6-methyl-N-(2-methyl-3-pyridinyl)-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthrene-2-carboxamide |
| SMILES | Cc1ncccc1NC(=O)c1ccc2c(c1)CC[C@@H]1C[C@@](O)(c3ccccc3)[C@](C)(O)C[C@@]21Cc1ccccc1.[Na+] |
| InChI | InChI=1S/C35H36N2O3.Na/c1-24-31(14-9-19-36-24)37-32(38)27-16-18-30-26(20-27)15-17-29-22-35(40,28-12-7-4-8-13-28)33(2,39)23-34(29,30)21-25-10-5-3-6-11-25;/h3-14,16,18-20,29,39-40H,15,17,21-23H2,1-2H3,(H,37,38);/q;+1/t29-,33-,34-,35-;/m1./s1 |
| InChIKey | IWZHCDITUBEOIL-IDRVPNEDSA-N |
| XLogP | 3.12 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |