C36H37NO3 — CID 160583185
1-[(4bR,6R,7R,8aR)-4b-benzyl-6,7-dihydroxy-6-methyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl]-2-(2-methyl-3-pyridinyl)ethanone (PubChem CID 160583185) has the molecular formula C36H37NO3 and a molecular weight of 531.70 g/mol. Its IUPAC name is 1-[(4bR,6R,7R,8aR)-4b-benzyl-6,7-dihydroxy-6-methyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl]-2-(2-methyl-3-pyridinyl)ethanone.
| Compound Name | 1-[(4bR,6R,7R,8aR)-4b-benzyl-6,7-dihydroxy-6-methyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl]-2-(2-methyl-3-pyridinyl)ethanone |
|---|---|
| PubChem CID | 160583185 |
| Molecular Formula | C36H37NO3 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | 1-[(4bR,6R,7R,8aR)-4b-benzyl-6,7-dihydroxy-6-methyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl]-2-(2-methyl-3-pyridinyl)ethanone |
| SMILES | Cc1ncccc1CC(=O)c1ccc2c(c1)CC[C@@H]1C[C@@](O)(c3ccccc3)[C@](C)(O)C[C@@]21Cc1ccccc1 |
| InChI | InChI=1S/C36H37NO3/c1-25-27(12-9-19-37-25)21-33(38)29-16-18-32-28(20-29)15-17-31-23-36(40,30-13-7-4-8-14-30)34(2,39)24-35(31,32)22-26-10-5-3-6-11-26/h3-14,16,18-20,31,39-40H,15,17,21-24H2,1-2H3/t31-,34-,35-,36-/m1/s1 |
| InChIKey | RCAYZXLDYXFRBK-MBWVZDRISA-N |
| XLogP | 6.29 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |