C30H33NO3 — CID 67989229
(4bR,6R,7R,8aR)-4b-benzyl-6,7-dihydroxy-N,6-dimethyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthrene-2-carboxamide (PubChem CID 67989229) has the molecular formula C30H33NO3 and a molecular weight of 455.60 g/mol. Its IUPAC name is (4bR,6R,7R,8aR)-4b-benzyl-6,7-dihydroxy-N,6-dimethyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthrene-2-carboxamide.
| Compound Name | (4bR,6R,7R,8aR)-4b-benzyl-6,7-dihydroxy-N,6-dimethyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthrene-2-carboxamide |
|---|---|
| PubChem CID | 67989229 |
| Molecular Formula | C30H33NO3 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | (4bR,6R,7R,8aR)-4b-benzyl-6,7-dihydroxy-N,6-dimethyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthrene-2-carboxamide |
| SMILES | CNC(=O)c1ccc2c(c1)CC[C@@H]1C[C@@](O)(c3ccccc3)[C@](C)(O)C[C@@]21Cc1ccccc1 |
| InChI | InChI=1S/C30H33NO3/c1-28(33)20-29(18-21-9-5-3-6-10-21)25(19-30(28,34)24-11-7-4-8-12-24)15-13-22-17-23(27(32)31-2)14-16-26(22)29/h3-12,14,16-17,25,33-34H,13,15,18-20H2,1-2H3,(H,31,32)/t25-,28-,29-,30-/m1/s1 |
| InChIKey | BRKGVMFJVBHJIN-LOIHPRHOSA-N |
| XLogP | 4.52 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |