C25H30O3 — CID 58742353
1-[(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-6-methyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl]ethanone (PubChem CID 58742353) has the molecular formula C25H30O3 and a molecular weight of 378.51 g/mol. Its IUPAC name is 1-[(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-6-methyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl]ethanone.
| Compound Name | 1-[(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-6-methyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl]ethanone |
|---|---|
| PubChem CID | 58742353 |
| Molecular Formula | C25H30O3 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 1-[(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-6-methyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl]ethanone |
| SMILES | CC[C@@]12C[C@@](C)(O)[C@](O)(c3ccccc3)C[C@H]1CCc1cc(C(C)=O)ccc12 |
| InChI | InChI=1S/C25H30O3/c1-4-24-16-23(3,27)25(28,20-8-6-5-7-9-20)15-21(24)12-10-19-14-18(17(2)26)11-13-22(19)24/h5-9,11,13-14,21,27-28H,4,10,12,15-16H2,1-3H3/t21-,23-,24-,25-/m1/s1 |
| InChIKey | GYYGNVNZAHTJFR-WJNCPCKPSA-N |
| XLogP | 4.53 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |