C27H33NO3 — CID 10070720
4-[[(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-6-methyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl]oxy]butanenitrile (PubChem CID 10070720) has the molecular formula C27H33NO3 and a molecular weight of 419.57 g/mol. Its IUPAC name is 4-[[(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-6-methyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl]oxy]butanenitrile.
| Compound Name | 4-[[(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-6-methyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl]oxy]butanenitrile |
|---|---|
| PubChem CID | 10070720 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 4-[[(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-6-methyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl]oxy]butanenitrile |
| SMILES | CC[C@@]12C[C@@](C)(O)[C@](O)(c3ccccc3)C[C@H]1CCc1cc(OCCCC#N)ccc12 |
| InChI | InChI=1S/C27H33NO3/c1-3-26-19-25(2,29)27(30,21-9-5-4-6-10-21)18-22(26)12-11-20-17-23(13-14-24(20)26)31-16-8-7-15-28/h4-6,9-10,13-14,17,22,29-30H,3,7-8,11-12,16,18-19H2,1-2H3/t22-,25-,26-,27-/m1/s1 |
| InChIKey | BJYWKHZFRVDDSI-UUSJWDGRSA-N |
| XLogP | 5.01 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|