C26H34O4 — CID 142848204
(2R,3R)-4a-ethyl-7-(3-hydroxypropoxy)-3-methyl-2-phenyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3-diol (PubChem CID 142848204) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is (2R,3R)-4a-ethyl-7-(3-hydroxypropoxy)-3-methyl-2-phenyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3-diol.
| Compound Name | (2R,3R)-4a-ethyl-7-(3-hydroxypropoxy)-3-methyl-2-phenyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3-diol |
|---|---|
| PubChem CID | 142848204 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (2R,3R)-4a-ethyl-7-(3-hydroxypropoxy)-3-methyl-2-phenyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3-diol |
| SMILES | CCC12C[C@@](C)(O)[C@](O)(c3ccccc3)CC1CCc1cc(OCCCO)ccc12 |
| InChI | InChI=1S/C26H34O4/c1-3-25-18-24(2,28)26(29,20-8-5-4-6-9-20)17-21(25)11-10-19-16-22(12-13-23(19)25)30-15-7-14-27/h4-6,8-9,12-13,16,21,27-29H,3,7,10-11,14-15,17-18H2,1-2H3/t21?,24-,25?,26-/m1/s1 |
| InChIKey | OZWUCJICGSOPLX-RWXLYZPQSA-N |
| XLogP | 4.09 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|