C23H29NO2 — CID 68830964
(2R,3R,4aR,10aR)-3-amino-4a-ethyl-3-methyl-2-phenyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,7-diol (PubChem CID 68830964) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is (2R,3R,4aR,10aR)-3-amino-4a-ethyl-3-methyl-2-phenyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,7-diol.
| Compound Name | (2R,3R,4aR,10aR)-3-amino-4a-ethyl-3-methyl-2-phenyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,7-diol |
|---|---|
| PubChem CID | 68830964 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (2R,3R,4aR,10aR)-3-amino-4a-ethyl-3-methyl-2-phenyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,7-diol |
| SMILES | CC[C@@]12C[C@@](C)(N)[C@](O)(c3ccccc3)C[C@H]1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C23H29NO2/c1-3-22-15-21(2,24)23(26,17-7-5-4-6-8-17)14-18(22)10-9-16-13-19(25)11-12-20(16)22/h4-8,11-13,18,25-26H,3,9-10,14-15,24H2,1-2H3/t18-,21-,22-,23-/m1/s1 |
| InChIKey | FGIOHBYDDZOUPV-RLLPEYFOSA-N |
| XLogP | 4.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |