C22H24O2 — CID 25257699
(2R,4aR,10aR)-4a-ethyl-7-hydroxy-2-phenyl-1,2,4,9,10,10a-hexahydrophenanthren-3-one (PubChem CID 25257699) has the molecular formula C22H24O2 and a molecular weight of 320.43 g/mol. Its IUPAC name is (2R,4aR,10aR)-4a-ethyl-7-hydroxy-2-phenyl-1,2,4,9,10,10a-hexahydrophenanthren-3-one.
| Compound Name | (2R,4aR,10aR)-4a-ethyl-7-hydroxy-2-phenyl-1,2,4,9,10,10a-hexahydrophenanthren-3-one |
|---|---|
| PubChem CID | 25257699 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (2R,4aR,10aR)-4a-ethyl-7-hydroxy-2-phenyl-1,2,4,9,10,10a-hexahydrophenanthren-3-one |
| SMILES | CC[C@@]12CC(=O)[C@@H](c3ccccc3)C[C@H]1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C22H24O2/c1-2-22-14-21(24)19(15-6-4-3-5-7-15)13-17(22)9-8-16-12-18(23)10-11-20(16)22/h3-7,10-12,17,19,23H,2,8-9,13-14H2,1H3/t17-,19-,22-/m1/s1 |
| InChIKey | XVLGZKCUMJONJZ-SFGWALBWSA-N |
| XLogP | 4.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |