C16H20O3 — CID 25258385
(2S,4aR,10aR)-4a-ethyl-2,7-dihydroxy-1,2,4,9,10,10a-hexahydrophenanthren-3-one (PubChem CID 25258385) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is (2S,4aR,10aR)-4a-ethyl-2,7-dihydroxy-1,2,4,9,10,10a-hexahydrophenanthren-3-one.
| Compound Name | (2S,4aR,10aR)-4a-ethyl-2,7-dihydroxy-1,2,4,9,10,10a-hexahydrophenanthren-3-one |
|---|---|
| PubChem CID | 25258385 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (2S,4aR,10aR)-4a-ethyl-2,7-dihydroxy-1,2,4,9,10,10a-hexahydrophenanthren-3-one |
| SMILES | CC[C@@]12CC(=O)[C@@H](O)C[C@H]1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C16H20O3/c1-2-16-9-15(19)14(18)8-11(16)4-3-10-7-12(17)5-6-13(10)16/h5-7,11,14,17-18H,2-4,8-9H2,1H3/t11-,14+,16-/m1/s1 |
| InChIKey | DSSHWTJMAJAJCR-DIOULYMOSA-N |
| XLogP | 2.33 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |