C22H24ClFO3 — CID 142848180
(3S,4aR,10aR)-2-(3-chloro-5-fluorophenyl)-4a-ethyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,3,7-triol (PubChem CID 142848180) has the molecular formula C22H24ClFO3 and a molecular weight of 390.88 g/mol. Its IUPAC name is (3S,4aR,10aR)-2-(3-chloro-5-fluorophenyl)-4a-ethyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,3,7-triol.
| Compound Name | (3S,4aR,10aR)-2-(3-chloro-5-fluorophenyl)-4a-ethyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,3,7-triol |
|---|---|
| PubChem CID | 142848180 |
| Molecular Formula | C22H24ClFO3 |
| Molecular Weight | 390.88 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | (3S,4aR,10aR)-2-(3-chloro-5-fluorophenyl)-4a-ethyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,3,7-triol |
| SMILES | CC[C@@]12C[C@H](O)C(O)(c3cc(F)cc(Cl)c3)C[C@H]1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C22H24ClFO3/c1-2-21-12-20(26)22(27,15-8-16(23)10-17(24)9-15)11-14(21)4-3-13-7-18(25)5-6-19(13)21/h5-10,14,20,25-27H,2-4,11-12H2,1H3/t14-,20+,21-,22?/m1/s1 |
| InChIKey | BUGJYWTUTHCDHA-YWDBQKGISA-N |
| XLogP | 4.44 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.88 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |