C24H28O3 — CID 163431071
(3S,4aR,10aR)-2-benzyl-4a-prop-2-enyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,3,7-triol (PubChem CID 163431071) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is (3S,4aR,10aR)-2-benzyl-4a-prop-2-enyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,3,7-triol.
| Compound Name | (3S,4aR,10aR)-2-benzyl-4a-prop-2-enyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,3,7-triol |
|---|---|
| PubChem CID | 163431071 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (3S,4aR,10aR)-2-benzyl-4a-prop-2-enyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,3,7-triol |
| SMILES | C=CC[C@@]12C[C@H](O)C(O)(Cc3ccccc3)C[C@H]1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C24H28O3/c1-2-12-23-16-22(26)24(27,14-17-6-4-3-5-7-17)15-19(23)9-8-18-13-20(25)10-11-21(18)23/h2-7,10-11,13,19,22,25-27H,1,8-9,12,14-16H2/t19-,22+,23-,24?/m1/s1 |
| InChIKey | AQNMJMFOXMUMDW-QDLHARERSA-N |
| XLogP | 3.90 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|