C48H56O6 — CID 158477159
(2R,3S,4aR,10aR)-2-benzyl-4a-prop-2-enyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,3,7-triol;(2R,3R,4aR,10aR)-2-benzyl-4a-prop-2-enyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,3,7-triol (PubChem CID 158477159) has the molecular formula C48H56O6 and a molecular weight of 728.97 g/mol. Its IUPAC name is (2R,3S,4aR,10aR)-2-benzyl-4a-prop-2-enyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,3,7-triol;(2R,3R,4aR,10aR)-2-benzyl-4a-prop-2-enyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,3,7-triol.
| Compound Name | (2R,3S,4aR,10aR)-2-benzyl-4a-prop-2-enyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,3,7-triol;(2R,3R,4aR,10aR)-2-benzyl-4a-prop-2-enyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,3,7-triol |
|---|---|
| PubChem CID | 158477159 |
| Molecular Formula | C48H56O6 |
| Molecular Weight | 728.97 g/mol |
| Exact Mass | 728.41 |
| IUPAC Name | (2R,3S,4aR,10aR)-2-benzyl-4a-prop-2-enyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,3,7-triol;(2R,3R,4aR,10aR)-2-benzyl-4a-prop-2-enyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,3,7-triol |
| SMILES | C=CC[C@@]12C[C@@H](O)[C@](O)(Cc3ccccc3)C[C@H]1CCc1cc(O)ccc12.C=CC[C@@]12C[C@H](O)[C@](O)(Cc3ccccc3)C[C@H]1CCc1cc(O)ccc12 |
| InChI | InChI=1S/2C24H28O3/c2*1-2-12-23-16-22(26)24(27,14-17-6-4-3-5-7-17)15-19(23)9-8-18-13-20(25)10-11-21(18)23/h2*2-7,10-11,13,19,22,25-27H,1,8-9,12,14-16H2/t19-,22+,23-,24+;19-,22-,23-,24+/m11/s1 |
| InChIKey | HHBPRMJBJKDWJE-MQCXQLAPSA-N |
| XLogP | 7.79 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.97 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|