C27H28O2 — CID 68580774
(4aS,10aR)-4a-benzyl-2-phenyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol (PubChem CID 68580774) has the molecular formula C27H28O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is (4aS,10aR)-4a-benzyl-2-phenyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol.
| Compound Name | (4aS,10aR)-4a-benzyl-2-phenyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol |
|---|---|
| PubChem CID | 68580774 |
| Molecular Formula | C27H28O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | (4aS,10aR)-4a-benzyl-2-phenyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol |
| SMILES | Oc1ccc2c(c1)CC[C@@H]1CC(O)(c3ccccc3)CC[C@@]21Cc1ccccc1 |
| InChI | InChI=1S/C27H28O2/c28-24-13-14-25-21(17-24)11-12-23-19-27(29,22-9-5-2-6-10-22)16-15-26(23,25)18-20-7-3-1-4-8-20/h1-10,13-14,17,23,28-29H,11-12,15-16,18-19H2/t23-,26+,27?/m1/s1 |
| InChIKey | ISYBJMVOALOSHF-KSFIVCTKSA-N |
| XLogP | 5.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |