C29H29F3O4S — CID 131740522
[(1S,11S)-1-benzyl-13-hydroxy-13-phenyl-5-tricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trienyl] trifluoromethanesulfonate (PubChem CID 131740522) has the molecular formula C29H29F3O4S and a molecular weight of 530.61 g/mol. Its IUPAC name is [(1S,11S)-1-benzyl-13-hydroxy-13-phenyl-5-tricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trienyl] trifluoromethanesulfonate.
| Compound Name | [(1S,11S)-1-benzyl-13-hydroxy-13-phenyl-5-tricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trienyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 131740522 |
| Molecular Formula | C29H29F3O4S |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | [(1S,11S)-1-benzyl-13-hydroxy-13-phenyl-5-tricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trienyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)CCC[C@H]1CC(O)(c3ccccc3)CC[C@@]21Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C29H29F3O4S/c30-29(31,32)37(34,35)36-25-14-15-26-22(18-25)10-7-13-24-20-28(33,23-11-5-2-6-12-23)17-16-27(24,26)19-21-8-3-1-4-9-21/h1-6,8-9,11-12,14-15,18,24,33H,7,10,13,16-17,19-20H2/t24-,27-,28?/m0/s1 |
| InChIKey | RQDHUBBQDIGIJE-USLGXFOBSA-N |
| XLogP | 6.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|